C8H13N3O4 — CID 25110755
(2Z)-2-[3-(diaminomethylideneamino)propylidene]butanedioic acid (PubChem CID 25110755) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is (2Z)-2-[3-(diaminomethylideneamino)propylidene]butanedioic acid.
| Compound Name | (2Z)-2-[3-(diaminomethylideneamino)propylidene]butanedioic acid |
|---|---|
| PubChem CID | 25110755 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (2Z)-2-[3-(diaminomethylideneamino)propylidene]butanedioic acid |
| SMILES | NC(N)=NCC/C=C(/CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H13N3O4/c9-8(10)11-3-1-2-5(7(14)15)4-6(12)13/h2H,1,3-4H2,(H,12,13)(H,14,15)(H4,9,10,11)/b5-2- |
| InChIKey | FQUBLGQMXQHASY-DJWKRKHSSA-N |
| XLogP | -0.86 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|