C8H16N4 — CID 88665235
2-(4-aminohepta-3,5-dienyl)guanidine (PubChem CID 88665235) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(4-aminohepta-3,5-dienyl)guanidine.
| Compound Name | 2-(4-aminohepta-3,5-dienyl)guanidine |
|---|---|
| PubChem CID | 88665235 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 2-(4-aminohepta-3,5-dienyl)guanidine |
| SMILES | CC=CC(N)=CCCN=C(N)N |
| InChI | InChI=1S/C8H16N4/c1-2-4-7(9)5-3-6-12-8(10)11/h2,4-5H,3,6,9H2,1H3,(H4,10,11,12) |
| InChIKey | FOFGRACYGRTWKL-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|