C6H11N3O4 — CID 175207726
2-[2-(diaminomethylideneamino)acetyl]oxypropanoic acid (PubChem CID 175207726) has the molecular formula C6H11N3O4 and a molecular weight of 189.17 g/mol. Its IUPAC name is 2-[2-(diaminomethylideneamino)acetyl]oxypropanoic acid.
| Compound Name | 2-[2-(diaminomethylideneamino)acetyl]oxypropanoic acid |
|---|---|
| PubChem CID | 175207726 |
| Molecular Formula | C6H11N3O4 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 2-[2-(diaminomethylideneamino)acetyl]oxypropanoic acid |
| SMILES | CC(OC(=O)CN=C(N)N)C(=O)O |
| InChI | InChI=1S/C6H11N3O4/c1-3(5(11)12)13-4(10)2-9-6(7)8/h3H,2H2,1H3,(H,11,12)(H4,7,8,9) |
| InChIKey | FEIDUKFQCPGWIW-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|