About 2-ethylguanidine;nitrous acid
2-ethylguanidine;nitrous acid (PubChem CID 174966669) has the molecular formula C3H10N4O2
and a molecular weight of 134.14 g/mol. Its IUPAC name is 2-ethylguanidine;nitrous acid.
Molecular Properties
| Compound Name | 2-ethylguanidine;nitrous acid |
| PubChem CID | 174966669 |
| Molecular Formula | C3H10N4O2 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 2-ethylguanidine;nitrous acid |
| SMILES | CCN=C(N)N.O=NO |
| InChI | InChI=1S/C3H9N3.HNO2/c1-2-6-3(4)5;2-1-3/h2H2,1H3,(H4,4,5,6);(H,2,3) |
| InChIKey | WKSDFENIILXCPK-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylguanidine;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylguanidine;nitrous acid?
The IUPAC name of 2-ethylguanidine;nitrous acid (CID 174966669) is 2-ethylguanidine;nitrous acid.
What is the SMILES notation for 2-ethylguanidine;nitrous acid?
The canonical SMILES for 2-ethylguanidine;nitrous acid is CCN=C(N)N.O=NO.
What is the InChIKey of 2-ethylguanidine;nitrous acid?
The InChIKey is WKSDFENIILXCPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N3.HNO2/c1-2-6-3(4)5;2-1-3/h2H2,1H3,(H4,4,5,6);(H,2,3).
What are the key properties of 2-ethylguanidine;nitrous acid?
2-ethylguanidine;nitrous acid has a molecular weight of 134.14 g/mol, XLogP of -0.58, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylguanidine;nitrous acid is sourced from PubChem (CID 174966669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).