C9H20N2O2 — CID 126622878
N'-(2,2-dimethoxyethyl)pentanimidamide (PubChem CID 126622878) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N'-(2,2-dimethoxyethyl)pentanimidamide.
| Compound Name | N'-(2,2-dimethoxyethyl)pentanimidamide |
|---|---|
| PubChem CID | 126622878 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | N'-(2,2-dimethoxyethyl)pentanimidamide |
| SMILES | CCCC/C(N)=N\CC(OC)OC |
| InChI | InChI=1S/C9H20N2O2/c1-4-5-6-8(10)11-7-9(12-2)13-3/h9H,4-7H2,1-3H3,(H2,10,11) |
| InChIKey | IRADQMRBSRKMGK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|