C13H28ClN3O3 — CID 161011077
2-(1-aminopentylideneamino)acetic acid;methyl pentanimidate;hydrochloride (PubChem CID 161011077) has the molecular formula C13H28ClN3O3 and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-(1-aminopentylideneamino)acetic acid;methyl pentanimidate;hydrochloride.
| Compound Name | 2-(1-aminopentylideneamino)acetic acid;methyl pentanimidate;hydrochloride |
|---|---|
| PubChem CID | 161011077 |
| Molecular Formula | C13H28ClN3O3 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 2-(1-aminopentylideneamino)acetic acid;methyl pentanimidate;hydrochloride |
| SMILES | CCCC/C(N)=N\CC(=O)O.Cl.[H]/N=C(/CCCC)OC |
| InChI | InChI=1S/C7H14N2O2.C6H13NO.ClH/c1-2-3-4-6(8)9-5-7(10)11;1-3-4-5-6(7)8-2;/h2-5H2,1H3,(H2,8,9)(H,10,11);7H,3-5H2,1-2H3;1H/b;7-6-; |
| InChIKey | RKBBXKQFYMNJQF-IICHUWEQSA-N |
| XLogP | 2.84 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|