C20H40N6O6 — CID 164711241
(2R,3S,4R,5S)-N-[2-[(1,8-diamino-8-propyliminooctylidene)amino]ethyl]-2,3,4,5-tetrahydroxy-N'-methylhexanediamide (PubChem CID 164711241) has the molecular formula C20H40N6O6 and a molecular weight of 460.58 g/mol. Its IUPAC name is (2R,3S,4R,5S)-N-[2-[(1,8-diamino-8-propyliminooctylidene)amino]ethyl]-2,3,4,5-tetrahydroxy-N'-methylhexanediamide.
| Compound Name | (2R,3S,4R,5S)-N-[2-[(1,8-diamino-8-propyliminooctylidene)amino]ethyl]-2,3,4,5-tetrahydroxy-N'-methylhexanediamide |
|---|---|
| PubChem CID | 164711241 |
| Molecular Formula | C20H40N6O6 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (2R,3S,4R,5S)-N-[2-[(1,8-diamino-8-propyliminooctylidene)amino]ethyl]-2,3,4,5-tetrahydroxy-N'-methylhexanediamide |
| SMILES | CCC/N=C(\N)CCCCCC/C(N)=N\CCNC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)NC |
| InChI | InChI=1S/C20H40N6O6/c1-3-10-24-13(21)8-6-4-5-7-9-14(22)25-11-12-26-20(32)18(30)16(28)15(27)17(29)19(31)23-2/h15-18,27-30H,3-12H2,1-2H3,(H2,21,24)(H2,22,25)(H,23,31)(H,26,32)/t15-,16+,17+,18-/m1/s1 |
| InChIKey | RNRXAMWYQZIRGS-VSZNYVQBSA-N |
| XLogP | -2.24 |
| TPSA | 215.88 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|