C23H48N4O8 — CID 87948331
N-[2-(diaminomethylideneamino)ethyl]tetradecanamide;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 87948331) has the molecular formula C23H48N4O8 and a molecular weight of 508.66 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)ethyl]tetradecanamide;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | N-[2-(diaminomethylideneamino)ethyl]tetradecanamide;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 87948331 |
| Molecular Formula | C23H48N4O8 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.35 |
| IUPAC Name | N-[2-(diaminomethylideneamino)ethyl]tetradecanamide;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | CCCCCCCCCCCCCC(=O)NCCN=C(N)N.O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C17H36N4O.C6H12O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(22)20-14-15-21-17(18)19;7-1-2(8)3(9)4(10)5(11)6(12)13/h2-15H2,1H3,(H,20,22)(H4,18,19,21);2-5,7-11H,1H2,(H,12,13)/t;2-,3-,4+,5-/m.1/s1 |
| InChIKey | RUQKFVLMFWBWPC-IFWQJVLJSA-N |
| XLogP | -0.42 |
| TPSA | 231.95 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|