C27H54N6O4 — CID 154986376
N-[2-[[1,8-diamino-8-(3,3-dimethylbutylimino)octylidene]amino]ethyl]-2,3-dihydroxy-N'-(2-methylbutan-2-yl)hexanediamide (PubChem CID 154986376) has the molecular formula C27H54N6O4 and a molecular weight of 526.77 g/mol. Its IUPAC name is N-[2-[[1,8-diamino-8-(3,3-dimethylbutylimino)octylidene]amino]ethyl]-2,3-dihydroxy-N'-(2-methylbutan-2-yl)hexanediamide.
| Compound Name | N-[2-[[1,8-diamino-8-(3,3-dimethylbutylimino)octylidene]amino]ethyl]-2,3-dihydroxy-N'-(2-methylbutan-2-yl)hexanediamide |
|---|---|
| PubChem CID | 154986376 |
| Molecular Formula | C27H54N6O4 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.42 |
| IUPAC Name | N-[2-[[1,8-diamino-8-(3,3-dimethylbutylimino)octylidene]amino]ethyl]-2,3-dihydroxy-N'-(2-methylbutan-2-yl)hexanediamide |
| SMILES | CCC(C)(C)NC(=O)CCC(O)C(O)C(=O)NCC/N=C(/N)CCCCCC/C(N)=N/CCC(C)(C)C |
| InChI | InChI=1S/C27H54N6O4/c1-7-27(5,6)33-23(35)15-14-20(34)24(36)25(37)32-19-18-31-22(29)13-11-9-8-10-12-21(28)30-17-16-26(2,3)4/h20,24,34,36H,7-19H2,1-6H3,(H2,28,30)(H2,29,31)(H,32,37)(H,33,35) |
| InChIKey | LASHUPQGYLEXOK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 175.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|