C18H35N5O4 — CID 171843661
N-[6-(carbamoylamino)-2-oxohexan-3-yl]-2-(methylamino)-N'-(2-methylbutan-2-yl)pentanediamide (PubChem CID 171843661) has the molecular formula C18H35N5O4 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[6-(carbamoylamino)-2-oxohexan-3-yl]-2-(methylamino)-N'-(2-methylbutan-2-yl)pentanediamide.
| Compound Name | N-[6-(carbamoylamino)-2-oxohexan-3-yl]-2-(methylamino)-N'-(2-methylbutan-2-yl)pentanediamide |
|---|---|
| PubChem CID | 171843661 |
| Molecular Formula | C18H35N5O4 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | N-[6-(carbamoylamino)-2-oxohexan-3-yl]-2-(methylamino)-N'-(2-methylbutan-2-yl)pentanediamide |
| SMILES | CCC(C)(C)NC(=O)CCC(NC)C(=O)NC(CCCNC(N)=O)C(C)=O |
| InChI | InChI=1S/C18H35N5O4/c1-6-18(3,4)23-15(25)10-9-14(20-5)16(26)22-13(12(2)24)8-7-11-21-17(19)27/h13-14,20H,6-11H2,1-5H3,(H,22,26)(H,23,25)(H3,19,21,27) |
| InChIKey | FECOJMHQAFJRFN-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|