C21H39N5O5 — CID 139457883
N-[2-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]-6-(2-ethylbutanoylamino)hexanamide (PubChem CID 139457883) has the molecular formula C21H39N5O5 and a molecular weight of 441.57 g/mol. Its IUPAC name is N-[2-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]-6-(2-ethylbutanoylamino)hexanamide.
| Compound Name | N-[2-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]-6-(2-ethylbutanoylamino)hexanamide |
|---|---|
| PubChem CID | 139457883 |
| Molecular Formula | C21H39N5O5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | N-[2-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]-6-(2-ethylbutanoylamino)hexanamide |
| SMILES | CCC(CC)C(=O)NCCCCCC(=O)NCC(=O)NC(CCCNC(N)=O)C(C)=O |
| InChI | InChI=1S/C21H39N5O5/c1-4-16(5-2)20(30)23-12-8-6-7-11-18(28)25-14-19(29)26-17(15(3)27)10-9-13-24-21(22)31/h16-17H,4-14H2,1-3H3,(H,23,30)(H,25,28)(H,26,29)(H3,22,24,31) |
| InChIKey | MBYUYLAEHHBHPT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 159.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|