C23H47N7O6 — CID 90382683
(2R,3S,4R,5S)-N-[2-[[1,8-diamino-8-[2-(tert-butylamino)ethylimino]octylidene]amino]ethyl]-2,3,4,5-tetrahydroxy-N'-methylhexanediamide (PubChem CID 90382683) has the molecular formula C23H47N7O6 and a molecular weight of 517.67 g/mol. Its IUPAC name is (2R,3S,4R,5S)-N-[2-[[1,8-diamino-8-[2-(tert-butylamino)ethylimino]octylidene]amino]ethyl]-2,3,4,5-tetrahydroxy-N'-methylhexanediamide.
| Compound Name | (2R,3S,4R,5S)-N-[2-[[1,8-diamino-8-[2-(tert-butylamino)ethylimino]octylidene]amino]ethyl]-2,3,4,5-tetrahydroxy-N'-methylhexanediamide |
|---|---|
| PubChem CID | 90382683 |
| Molecular Formula | C23H47N7O6 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.36 |
| IUPAC Name | (2R,3S,4R,5S)-N-[2-[[1,8-diamino-8-[2-(tert-butylamino)ethylimino]octylidene]amino]ethyl]-2,3,4,5-tetrahydroxy-N'-methylhexanediamide |
| SMILES | CNC(=O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)NCC/N=C(/N)CCCCCC/C(N)=N/CCNC(C)(C)C |
| InChI | InChI=1S/C23H47N7O6/c1-23(2,3)30-14-13-28-16(25)10-8-6-5-7-9-15(24)27-11-12-29-22(36)20(34)18(32)17(31)19(33)21(35)26-4/h17-20,30-34H,5-14H2,1-4H3,(H2,24,27)(H2,25,28)(H,26,35)(H,29,36)/t17-,18+,19+,20-/m1/s1 |
| InChIKey | DBSOEVQTHQGRCE-FUMNGEBKSA-N |
| XLogP | -2.26 |
| TPSA | 227.91 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|