C28H57N7O6 — CID 90382243
(2S,3R,4S,5R)-N-tert-butyl-N'-[2-[[1,8-diamino-8-[2-(3-methylpentan-3-ylamino)ethylimino]octylidene]amino]ethyl]-2,3,4,5-tetrahydroxyhexanediamide (PubChem CID 90382243) has the molecular formula C28H57N7O6 and a molecular weight of 587.81 g/mol. Its IUPAC name is (2S,3R,4S,5R)-N-tert-butyl-N'-[2-[[1,8-diamino-8-[2-(3-methylpentan-3-ylamino)ethylimino]octylidene]amino]ethyl]-2,3,4,5-tetrahydroxyhexanediamide.
| Compound Name | (2S,3R,4S,5R)-N-tert-butyl-N'-[2-[[1,8-diamino-8-[2-(3-methylpentan-3-ylamino)ethylimino]octylidene]amino]ethyl]-2,3,4,5-tetrahydroxyhexanediamide |
|---|---|
| PubChem CID | 90382243 |
| Molecular Formula | C28H57N7O6 |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.44 |
| IUPAC Name | (2S,3R,4S,5R)-N-tert-butyl-N'-[2-[[1,8-diamino-8-[2-(3-methylpentan-3-ylamino)ethylimino]octylidene]amino]ethyl]-2,3,4,5-tetrahydroxyhexanediamide |
| SMILES | CCC(C)(CC)NCC/N=C(\N)CCCCCC/C(N)=N\CCNC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C28H57N7O6/c1-7-28(6,8-2)34-18-17-32-20(30)14-12-10-9-11-13-19(29)31-15-16-33-25(40)23(38)21(36)22(37)24(39)26(41)35-27(3,4)5/h21-24,34,36-39H,7-18H2,1-6H3,(H2,29,31)(H2,30,32)(H,33,40)(H,35,41)/t21-,22+,23+,24-/m0/s1 |
| InChIKey | NNDPZKYIBRIWOH-KEZOAJOQSA-N |
| XLogP | -0.32 |
| TPSA | 227.91 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|