C13H26N2O6 — CID 130268305
(2R,3S,4R,5S)-N-tert-butyl-2,3,4,5-tetrahydroxy-N'-propan-2-ylhexanediamide (PubChem CID 130268305) has the molecular formula C13H26N2O6 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2R,3S,4R,5S)-N-tert-butyl-2,3,4,5-tetrahydroxy-N'-propan-2-ylhexanediamide.
| Compound Name | (2R,3S,4R,5S)-N-tert-butyl-2,3,4,5-tetrahydroxy-N'-propan-2-ylhexanediamide |
|---|---|
| PubChem CID | 130268305 |
| Molecular Formula | C13H26N2O6 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2R,3S,4R,5S)-N-tert-butyl-2,3,4,5-tetrahydroxy-N'-propan-2-ylhexanediamide |
| SMILES | CC(C)NC(=O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H26N2O6/c1-6(2)14-11(20)9(18)7(16)8(17)10(19)12(21)15-13(3,4)5/h6-10,16-19H,1-5H3,(H,14,20)(H,15,21)/t7-,8+,9+,10-/m1/s1 |
| InChIKey | WJNQBLWVABECJQ-XFWSIPNHSA-N |
| XLogP | -2.13 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |