C32H65N7O6 — CID 147447043
(2R,3S,4R,5S)-N-[2-[[1,8-diamino-8-[2-(3-methylhexan-3-ylamino)ethylimino]octylidene]amino]ethyl]-2,3,4,5-tetrahydroxy-N'-(3-methylhexan-3-yl)hexanediamide (PubChem CID 147447043) has the molecular formula C32H65N7O6 and a molecular weight of 643.91 g/mol. Its IUPAC name is (2R,3S,4R,5S)-N-[2-[[1,8-diamino-8-[2-(3-methylhexan-3-ylamino)ethylimino]octylidene]amino]ethyl]-2,3,4,5-tetrahydroxy-N'-(3-methylhexan-3-yl)hexanediamide.
| Compound Name | (2R,3S,4R,5S)-N-[2-[[1,8-diamino-8-[2-(3-methylhexan-3-ylamino)ethylimino]octylidene]amino]ethyl]-2,3,4,5-tetrahydroxy-N'-(3-methylhexan-3-yl)hexanediamide |
|---|---|
| PubChem CID | 147447043 |
| Molecular Formula | C32H65N7O6 |
| Molecular Weight | 643.91 g/mol |
| Exact Mass | 643.50 |
| IUPAC Name | (2R,3S,4R,5S)-N-[2-[[1,8-diamino-8-[2-(3-methylhexan-3-ylamino)ethylimino]octylidene]amino]ethyl]-2,3,4,5-tetrahydroxy-N'-(3-methylhexan-3-yl)hexanediamide |
| SMILES | CCCC(C)(CC)NCC/N=C(\N)CCCCCC/C(N)=N\CCNC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)NC(C)(CC)CCC |
| InChI | InChI=1S/C32H65N7O6/c1-7-17-31(5,9-3)38-22-21-36-24(34)16-14-12-11-13-15-23(33)35-19-20-37-29(44)27(42)25(40)26(41)28(43)30(45)39-32(6,10-4)18-8-2/h25-28,38,40-43H,7-22H2,1-6H3,(H2,33,35)(H2,34,36)(H,37,44)(H,39,45)/t25-,26+,27+,28-,31?,32?/m0/s1 |
| InChIKey | DXHZAZWSCPRSQU-RFHCQSOJSA-N |
| XLogP | 1.24 |
| TPSA | 227.91 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.91 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|