C28H56N6O4 — CID 154986347
N-[2-[[1,8-diamino-8-(3,3-dimethylpentylimino)octylidene]amino]ethyl]-2,3-dihydroxy-N'-(2-methylbutan-2-yl)hexanediamide (PubChem CID 154986347) has the molecular formula C28H56N6O4 and a molecular weight of 540.79 g/mol. Its IUPAC name is N-[2-[[1,8-diamino-8-(3,3-dimethylpentylimino)octylidene]amino]ethyl]-2,3-dihydroxy-N'-(2-methylbutan-2-yl)hexanediamide.
| Compound Name | N-[2-[[1,8-diamino-8-(3,3-dimethylpentylimino)octylidene]amino]ethyl]-2,3-dihydroxy-N'-(2-methylbutan-2-yl)hexanediamide |
|---|---|
| PubChem CID | 154986347 |
| Molecular Formula | C28H56N6O4 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.44 |
| IUPAC Name | N-[2-[[1,8-diamino-8-(3,3-dimethylpentylimino)octylidene]amino]ethyl]-2,3-dihydroxy-N'-(2-methylbutan-2-yl)hexanediamide |
| SMILES | CCC(C)(C)CC/N=C(\N)CCCCCC/C(N)=N\CCNC(=O)C(O)C(O)CCC(=O)NC(C)(C)CC |
| InChI | InChI=1S/C28H56N6O4/c1-7-27(3,4)17-18-31-22(29)13-11-9-10-12-14-23(30)32-19-20-33-26(38)25(37)21(35)15-16-24(36)34-28(5,6)8-2/h21,25,35,37H,7-20H2,1-6H3,(H2,29,31)(H2,30,32)(H,33,38)(H,34,36) |
| InChIKey | AMHBBOUVNOWZNN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 175.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|