C18H38N2Si — CID 173071738
N,N'-dihexyl-2-[methyl(prop-2-enyl)silyl]ethanimidamide (PubChem CID 173071738) has the molecular formula C18H38N2Si and a molecular weight of 310.60 g/mol. Its IUPAC name is N,N'-dihexyl-2-[methyl(prop-2-enyl)silyl]ethanimidamide.
| Compound Name | N,N'-dihexyl-2-[methyl(prop-2-enyl)silyl]ethanimidamide |
|---|---|
| PubChem CID | 173071738 |
| Molecular Formula | C18H38N2Si |
| Molecular Weight | 310.60 g/mol |
| Exact Mass | 310.28 |
| IUPAC Name | N,N'-dihexyl-2-[methyl(prop-2-enyl)silyl]ethanimidamide |
| SMILES | C=CC[SiH](C)C/C(=N/CCCCCC)NCCCCCC |
| InChI | InChI=1S/C18H38N2Si/c1-5-8-10-12-14-19-18(17-21(4)16-7-3)20-15-13-11-9-6-2/h7,21H,3,5-6,8-17H2,1-2,4H3,(H,19,20) |
| InChIKey | PHIRKVWXNIXFDH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|