C10H14N4 — CID 70522604
2-N'-(2-phenylethyl)ethanediimidamide (PubChem CID 70522604) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-N'-(2-phenylethyl)ethanediimidamide.
| Compound Name | 2-N'-(2-phenylethyl)ethanediimidamide |
|---|---|
| PubChem CID | 70522604 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-N'-(2-phenylethyl)ethanediimidamide |
| SMILES | [H]/N=C(N)/C(N)=N/CCc1ccccc1 |
| InChI | InChI=1S/C10H14N4/c11-9(12)10(13)14-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H3,11,12)(H2,13,14) |
| InChIKey | WBNBYLQEOKDVFG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|