C11H17N3 — CID 172789846
N'-(4-aminobutyl)benzenecarboximidamide (PubChem CID 172789846) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N'-(4-aminobutyl)benzenecarboximidamide.
| Compound Name | N'-(4-aminobutyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 172789846 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N'-(4-aminobutyl)benzenecarboximidamide |
| SMILES | NCCCC/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C11H17N3/c12-8-4-5-9-14-11(13)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9,12H2,(H2,13,14) |
| InChIKey | PKGNDUUAULIESW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|