C39H47N9O3 — CID 21059198
N'-[5-[2,4,6-trioxo-3,5-bis[5-(phenyliminomethylideneamino)pentyl]-1,3,5-triazinan-1-yl]pentyl]benzenecarboximidamide (PubChem CID 21059198) has the molecular formula C39H47N9O3 and a molecular weight of 689.87 g/mol. Its IUPAC name is N'-[5-[2,4,6-trioxo-3,5-bis[5-(phenyliminomethylideneamino)pentyl]-1,3,5-triazinan-1-yl]pentyl]benzenecarboximidamide.
| Compound Name | N'-[5-[2,4,6-trioxo-3,5-bis[5-(phenyliminomethylideneamino)pentyl]-1,3,5-triazinan-1-yl]pentyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 21059198 |
| Molecular Formula | C39H47N9O3 |
| Molecular Weight | 689.87 g/mol |
| Exact Mass | 689.38 |
| IUPAC Name | N'-[5-[2,4,6-trioxo-3,5-bis[5-(phenyliminomethylideneamino)pentyl]-1,3,5-triazinan-1-yl]pentyl]benzenecarboximidamide |
| SMILES | N/C(=N\CCCCCn1c(=O)n(CCCCCN=C=Nc2ccccc2)c(=O)n(CCCCCN=C=Nc2ccccc2)c1=O)c1ccccc1 |
| InChI | InChI=1S/C39H47N9O3/c40-36(33-19-7-1-8-20-33)43-27-15-6-18-30-48-38(50)46(28-16-4-13-25-41-31-44-34-21-9-2-10-22-34)37(49)47(39(48)51)29-17-5-14-26-42-32-45-35-23-11-3-12-24-35/h1-3,7-12,19-24H,4-6,13-18,25-30H2,(H2,40,43) |
| InChIKey | AUDIIDIFSKBGBC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 153.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.87 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|