C12H17F2N5 — CID 5487318
2-(3-aminopropyl)-1-[(Z)-(2,2-difluoro-1-phenylethylidene)amino]guanidine (PubChem CID 5487318) has the molecular formula C12H17F2N5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(3-aminopropyl)-1-[(Z)-(2,2-difluoro-1-phenylethylidene)amino]guanidine.
| Compound Name | 2-(3-aminopropyl)-1-[(Z)-(2,2-difluoro-1-phenylethylidene)amino]guanidine |
|---|---|
| PubChem CID | 5487318 |
| Molecular Formula | C12H17F2N5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-(3-aminopropyl)-1-[(Z)-(2,2-difluoro-1-phenylethylidene)amino]guanidine |
| SMILES | NCCC/N=C(\N)N/N=C(/c1ccccc1)C(F)F |
| InChI | InChI=1S/C12H17F2N5/c13-11(14)10(9-5-2-1-3-6-9)18-19-12(16)17-8-4-7-15/h1-3,5-6,11H,4,7-8,15H2,(H3,16,17,19)/b18-10- |
| InChIKey | MPBKAOHKPAKJDA-ZDLGFXPLSA-N |
| XLogP | 0.91 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|