C17H21N7 — CID 140813812
1,2-bis[(2-amino-1-phenylethylidene)amino]guanidine (PubChem CID 140813812) has the molecular formula C17H21N7 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1,2-bis[(2-amino-1-phenylethylidene)amino]guanidine.
| Compound Name | 1,2-bis[(2-amino-1-phenylethylidene)amino]guanidine |
|---|---|
| PubChem CID | 140813812 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 1,2-bis[(2-amino-1-phenylethylidene)amino]guanidine |
| SMILES | NCC(=N/N=C(/N)NN=C(CN)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H21N7/c18-11-15(13-7-3-1-4-8-13)21-23-17(20)24-22-16(12-19)14-9-5-2-6-10-14/h1-10H,11-12,18-19H2,(H3,20,23,24) |
| InChIKey | OHIVDCZHHGPLKK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|