C17H17N11 — CID 86279334
1,2-bis[(Z)-(2-azido-1-phenylethylidene)amino]guanidine (PubChem CID 86279334) has the molecular formula C17H17N11 and a molecular weight of 375.40 g/mol. Its IUPAC name is 1,2-bis[(Z)-(2-azido-1-phenylethylidene)amino]guanidine.
| Compound Name | 1,2-bis[(Z)-(2-azido-1-phenylethylidene)amino]guanidine |
|---|---|
| PubChem CID | 86279334 |
| Molecular Formula | C17H17N11 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1,2-bis[(Z)-(2-azido-1-phenylethylidene)amino]guanidine |
| SMILES | [N-]=[N+]=NC/C(=N\N=C(/N)N/N=C(\CN=[N+]=[N-])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17N11/c18-17(25-23-15(11-21-27-19)13-7-3-1-4-8-13)26-24-16(12-22-28-20)14-9-5-2-6-10-14/h1-10H,11-12H2,(H3,18,25,26)/b23-15+,24-16+ |
| InChIKey | ZDIZHDYTOAALKB-DFEHQXHXSA-N |
| XLogP | 3.32 |
| TPSA | 172.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|