C13H19Cl2N5O — CID 70216346
N-[N'-(3-aminopropyl)carbamimidoyl]-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 70216346) has the molecular formula C13H19Cl2N5O and a molecular weight of 332.24 g/mol. Its IUPAC name is N-[N'-(3-aminopropyl)carbamimidoyl]-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[N'-(3-aminopropyl)carbamimidoyl]-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 70216346 |
| Molecular Formula | C13H19Cl2N5O |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[N'-(3-aminopropyl)carbamimidoyl]-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCCC/N=C(\N)NC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H17N5O.2ClH/c14-6-3-7-16-13(15)18-12(19)11-8-9-4-1-2-5-10(9)17-11;;/h1-2,4-5,8,17H,3,6-7,14H2,(H3,15,16,18,19);2*1H |
| InChIKey | JFUMSNHXSYMBCT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|