C18H26ClN5O3 — CID 70216919
tert-butyl N-[3-[[amino-(1H-indole-2-carbonylamino)methylidene]amino]propyl]carbamate;hydrochloride (PubChem CID 70216919) has the molecular formula C18H26ClN5O3 and a molecular weight of 395.89 g/mol. Its IUPAC name is tert-butyl N-[3-[[amino-(1H-indole-2-carbonylamino)methylidene]amino]propyl]carbamate;hydrochloride.
| Compound Name | tert-butyl N-[3-[[amino-(1H-indole-2-carbonylamino)methylidene]amino]propyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 70216919 |
| Molecular Formula | C18H26ClN5O3 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | tert-butyl N-[3-[[amino-(1H-indole-2-carbonylamino)methylidene]amino]propyl]carbamate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)NCCC/N=C(\N)NC(=O)c1cc2ccccc2[nH]1.Cl |
| InChI | InChI=1S/C18H25N5O3.ClH/c1-18(2,3)26-17(25)21-10-6-9-20-16(19)23-15(24)14-11-12-7-4-5-8-13(12)22-14;/h4-5,7-8,11,22H,6,9-10H2,1-3H3,(H,21,25)(H3,19,20,23,24);1H |
| InChIKey | GHHPYZRZMXTUKN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|