C10H10N4OS — CID 15483527
(1H-indole-2-carbonylamino)thiourea (PubChem CID 15483527) has the molecular formula C10H10N4OS and a molecular weight of 234.28 g/mol. Its IUPAC name is (1H-indole-2-carbonylamino)thiourea.
| Compound Name | (1H-indole-2-carbonylamino)thiourea |
|---|---|
| PubChem CID | 15483527 |
| Molecular Formula | C10H10N4OS |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (1H-indole-2-carbonylamino)thiourea |
| SMILES | NC(=S)NNC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H10N4OS/c11-10(16)14-13-9(15)8-5-6-3-1-2-4-7(6)12-8/h1-5,12H,(H,13,15)(H3,11,14,16) |
| InChIKey | AHSOFUKSHWGGAF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|