C16H32N2Si3 — CID 18461962
N,N,N'-tris(trimethylsilyl)benzenecarboximidamide (PubChem CID 18461962) has the molecular formula C16H32N2Si3 and a molecular weight of 336.70 g/mol. Its IUPAC name is N,N,N'-tris(trimethylsilyl)benzenecarboximidamide.
| Compound Name | N,N,N'-tris(trimethylsilyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 18461962 |
| Molecular Formula | C16H32N2Si3 |
| Molecular Weight | 336.70 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | N,N,N'-tris(trimethylsilyl)benzenecarboximidamide |
| SMILES | C[Si](C)(C)/N=C(/c1ccccc1)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H32N2Si3/c1-19(2,3)17-16(15-13-11-10-12-14-15)18(20(4,5)6)21(7,8)9/h10-14H,1-9H3/b17-16- |
| InChIKey | SNBOGYOPAAPNPK-MSUUIHNZSA-N |
| XLogP | 5.24 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.70 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|