About N,N,N'-triphenylbenzenecarboximidamide;hydrochloride
N,N,N'-triphenylbenzenecarboximidamide;hydrochloride (PubChem CID 163338390) has the molecular formula C25H21ClN2
and a molecular weight of 384.91 g/mol. Its IUPAC name is N,N,N'-triphenylbenzenecarboximidamide;hydrochloride.
Molecular Properties
| Compound Name | N,N,N'-triphenylbenzenecarboximidamide;hydrochloride |
| PubChem CID | 163338390 |
| Molecular Formula | C25H21ClN2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N,N,N'-triphenylbenzenecarboximidamide;hydrochloride |
| SMILES | Cl.c1ccc(/N=C(\c2ccccc2)N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N2.ClH/c1-5-13-21(14-6-1)25(26-22-15-7-2-8-16-22)27(23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h1-20H;1H/b26-25+; |
| InChIKey | MVZATRBZTUPOAT-BTKVJIOYSA-N |
| XLogP | 7.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N,N'-triphenylbenzenecarboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,N'-triphenylbenzenecarboximidamide;hydrochloride?
The IUPAC name of N,N,N'-triphenylbenzenecarboximidamide;hydrochloride (CID 163338390) is N,N,N'-triphenylbenzenecarboximidamide;hydrochloride.
What is the SMILES notation for N,N,N'-triphenylbenzenecarboximidamide;hydrochloride?
The canonical SMILES for N,N,N'-triphenylbenzenecarboximidamide;hydrochloride is Cl.c1ccc(/N=C(\c2ccccc2)N(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of N,N,N'-triphenylbenzenecarboximidamide;hydrochloride?
The InChIKey is MVZATRBZTUPOAT-BTKVJIOYSA-N. The full InChI is InChI=1S/C25H20N2.ClH/c1-5-13-21(14-6-1)25(26-22-15-7-2-8-16-22)27(23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h1-20H;1H/b26-25+;.
What are the key properties of N,N,N'-triphenylbenzenecarboximidamide;hydrochloride?
N,N,N'-triphenylbenzenecarboximidamide;hydrochloride has a molecular weight of 384.91 g/mol, XLogP of 7.03, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,N'-triphenylbenzenecarboximidamide;hydrochloride is sourced from PubChem (CID 163338390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).