C15H27NSi2 — CID 12930792
(E)-2-phenyl-N,N-bis(trimethylsilyl)prop-1-en-1-amine (PubChem CID 12930792) has the molecular formula C15H27NSi2 and a molecular weight of 277.56 g/mol. Its IUPAC name is (E)-2-phenyl-N,N-bis(trimethylsilyl)prop-1-en-1-amine.
| Compound Name | (E)-2-phenyl-N,N-bis(trimethylsilyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 12930792 |
| Molecular Formula | C15H27NSi2 |
| Molecular Weight | 277.56 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (E)-2-phenyl-N,N-bis(trimethylsilyl)prop-1-en-1-amine |
| SMILES | C/C(=C\N([Si](C)(C)C)[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H27NSi2/c1-14(15-11-9-8-10-12-15)13-16(17(2,3)4)18(5,6)7/h8-13H,1-7H3/b14-13+ |
| InChIKey | LCQWMQSOWIHJTI-BUHFOSPRSA-N |
| XLogP | 5.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|