C25H27N — CID 59845319
(E)-N,N-bis[(4-methylphenyl)methyl]-2-phenylprop-1-en-1-amine (PubChem CID 59845319) has the molecular formula C25H27N and a molecular weight of 341.50 g/mol. Its IUPAC name is (E)-N,N-bis[(4-methylphenyl)methyl]-2-phenylprop-1-en-1-amine.
| Compound Name | (E)-N,N-bis[(4-methylphenyl)methyl]-2-phenylprop-1-en-1-amine |
|---|---|
| PubChem CID | 59845319 |
| Molecular Formula | C25H27N |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (E)-N,N-bis[(4-methylphenyl)methyl]-2-phenylprop-1-en-1-amine |
| SMILES | C/C(=C\N(Cc1ccc(C)cc1)Cc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N/c1-20-9-13-23(14-10-20)18-26(19-24-15-11-21(2)12-16-24)17-22(3)25-7-5-4-6-8-25/h4-17H,18-19H2,1-3H3/b22-17+ |
| InChIKey | RKUSVRSMBCEMST-OQKWZONESA-N |
| XLogP | 6.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |