C22H30N4O3S — CID 42995076
N-[(E)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 42995076) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-[(E)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(E)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 42995076 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[(E)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | Cc1cc(/C=N/NC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)c(C)n1CC(C)C |
| InChI | InChI=1S/C22H30N4O3S/c1-16(2)15-26-17(3)12-20(18(26)4)14-23-24-22(27)19-8-7-9-21(13-19)30(28,29)25-10-5-6-11-25/h7-9,12-14,16H,5-6,10-11,15H2,1-4H3,(H,24,27)/b23-14+ |
| InChIKey | HHSRQWCFOKREGH-OEAKJJBVSA-N |
| XLogP | 3.31 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|