C21H27N5O — CID 46804372
N-[(E)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide (PubChem CID 46804372) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[(E)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide.
| Compound Name | N-[(E)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide |
|---|---|
| PubChem CID | 46804372 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N-[(E)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide |
| SMILES | Cc1cc(/C=N/NC(=O)Cc2nc3ccccc3n2C)c(C)n1CC(C)C |
| InChI | InChI=1S/C21H27N5O/c1-14(2)13-26-15(3)10-17(16(26)4)12-22-24-21(27)11-20-23-18-8-6-7-9-19(18)25(20)5/h6-10,12,14H,11,13H2,1-5H3,(H,24,27)/b22-12+ |
| InChIKey | JFLZXTONEDGSMH-WSDLNYQXSA-N |
| XLogP | 3.34 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|