C19H14F3N7O — CID 3099893
6-N-(2-methylphenyl)-5-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 3099893) has the molecular formula C19H14F3N7O and a molecular weight of 413.36 g/mol. Its IUPAC name is 6-N-(2-methylphenyl)-5-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 6-N-(2-methylphenyl)-5-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 3099893 |
| Molecular Formula | C19H14F3N7O |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 6-N-(2-methylphenyl)-5-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | Cc1ccccc1Nc1nc2nonc2nc1NN=Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H14F3N7O/c1-11-6-2-5-9-14(11)24-15-16(26-18-17(25-15)28-30-29-18)27-23-10-12-7-3-4-8-13(12)19(20,21)22/h2-10H,1H3,(H,24,25,28)(H,26,27,29) |
| InChIKey | CKLHXCDUPAGWKU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|