C19H15Cl2N7O — CID 92847110
5-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-6-N-(3,4-dimethylphenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 92847110) has the molecular formula C19H15Cl2N7O and a molecular weight of 428.28 g/mol. Its IUPAC name is 5-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-6-N-(3,4-dimethylphenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 5-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-6-N-(3,4-dimethylphenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 92847110 |
| Molecular Formula | C19H15Cl2N7O |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 5-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-6-N-(3,4-dimethylphenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | Cc1ccc(Nc2nc3nonc3nc2N/N=C\c2ccc(Cl)cc2Cl)cc1C |
| InChI | InChI=1S/C19H15Cl2N7O/c1-10-3-6-14(7-11(10)2)23-16-17(25-19-18(24-16)27-29-28-19)26-22-9-12-4-5-13(20)8-15(12)21/h3-9H,1-2H3,(H,23,24,27)(H,25,26,28)/b22-9- |
| InChIKey | NQBUJPRIXIZWBX-AFPJDJCSSA-N |
| XLogP | 5.13 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|