C16H15F3N2O2S — CID 6892667
2,5-dimethyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]benzenesulfonamide (PubChem CID 6892667) has the molecular formula C16H15F3N2O2S and a molecular weight of 356.37 g/mol. Its IUPAC name is 2,5-dimethyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 6892667 |
| Molecular Formula | C16H15F3N2O2S |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2,5-dimethyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N/N=C/c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F3N2O2S/c1-11-7-8-12(2)15(9-11)24(22,23)21-20-10-13-5-3-4-6-14(13)16(17,18)19/h3-10,21H,1-2H3/b20-10+ |
| InChIKey | FKNSRNCUSHWFIU-KEBDBYFISA-N |
| XLogP | 3.63 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|