C19H24N2O2 — CID 110504984
N-[(E)-(3-methoxy-2-propoxyphenyl)methylideneamino]-3,4-dimethylaniline (PubChem CID 110504984) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[(E)-(3-methoxy-2-propoxyphenyl)methylideneamino]-3,4-dimethylaniline.
| Compound Name | N-[(E)-(3-methoxy-2-propoxyphenyl)methylideneamino]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 110504984 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[(E)-(3-methoxy-2-propoxyphenyl)methylideneamino]-3,4-dimethylaniline |
| SMILES | CCCOc1c(/C=N/Nc2ccc(C)c(C)c2)cccc1OC |
| InChI | InChI=1S/C19H24N2O2/c1-5-11-23-19-16(7-6-8-18(19)22-4)13-20-21-17-10-9-14(2)15(3)12-17/h6-10,12-13,21H,5,11H2,1-4H3/b20-13+ |
| InChIKey | GSEDKBVJIYBJBX-DEDYPNTBSA-N |
| XLogP | 4.55 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|