C13H20N2O3 — CID 110839989
2-[2-[(3-methoxy-2-propoxyphenyl)methylidene]hydrazinyl]ethanol (PubChem CID 110839989) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[2-[(3-methoxy-2-propoxyphenyl)methylidene]hydrazinyl]ethanol.
| Compound Name | 2-[2-[(3-methoxy-2-propoxyphenyl)methylidene]hydrazinyl]ethanol |
|---|---|
| PubChem CID | 110839989 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-[2-[(3-methoxy-2-propoxyphenyl)methylidene]hydrazinyl]ethanol |
| SMILES | CCCOc1c(C=NNCCO)cccc1OC |
| InChI | InChI=1S/C13H20N2O3/c1-3-9-18-13-11(10-15-14-7-8-16)5-4-6-12(13)17-2/h4-6,10,14,16H,3,7-9H2,1-2H3 |
| InChIKey | OYEFGXSOXQLJJB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|