C10H16N4 — CID 130443214
2-[(E)-(dimethylhydrazinylidene)methyl]-4-N-methylbenzene-1,4-diamine (PubChem CID 130443214) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 2-[(E)-(dimethylhydrazinylidene)methyl]-4-N-methylbenzene-1,4-diamine.
| Compound Name | 2-[(E)-(dimethylhydrazinylidene)methyl]-4-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 130443214 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2-[(E)-(dimethylhydrazinylidene)methyl]-4-N-methylbenzene-1,4-diamine |
| SMILES | CNc1ccc(N)c(/C=N/N(C)C)c1 |
| InChI | InChI=1S/C10H16N4/c1-12-9-4-5-10(11)8(6-9)7-13-14(2)3/h4-7,12H,11H2,1-3H3/b13-7+ |
| InChIKey | FDANMCCZNXAYTL-NTUHNPAUSA-N |
| XLogP | 1.21 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|