About copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate
copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate (PubChem CID 170839629) has the molecular formula C14H12CuN2O4
and a molecular weight of 335.81 g/mol. Its IUPAC name is copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate.
Molecular Properties
| Compound Name | copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate |
| PubChem CID | 170839629 |
| Molecular Formula | C14H12CuN2O4 |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate |
| SMILES | O/N=C\c1ccccc1O.[Cu+2].[O-]/N=C\c1ccccc1[O-] |
| InChI | InChI=1S/2C7H7NO2.Cu/c2*9-7-4-2-1-3-6(7)5-8-10;/h2*1-5,9-10H;/q;;+2/p-2/b2*8-5-; |
| InChIKey | QTKMBUNAMYZSFC-ZFRXQFBVSA-L |
| XLogP | 1.87 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate?
The IUPAC name of copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate (CID 170839629) is copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate.
What is the SMILES notation for copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate?
The canonical SMILES for copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate is O/N=C\c1ccccc1O.[Cu+2].[O-]/N=C\c1ccccc1[O-].
What is the InChIKey of copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate?
The InChIKey is QTKMBUNAMYZSFC-ZFRXQFBVSA-L. The full InChI is InChI=1S/2C7H7NO2.Cu/c2*9-7-4-2-1-3-6(7)5-8-10;/h2*1-5,9-10H;/q;;+2/p-2/b2*8-5-;.
What are the key properties of copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate?
copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate has a molecular weight of 335.81 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;2-[(Z)-hydroxyiminomethyl]phenol;2-[(Z)-oxidoiminomethyl]phenolate is sourced from PubChem (CID 170839629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).