C22H26N2O2 — CID 159587394
2-[[2-[(2-hydroxy-4-methylphenyl)methylideneamino]cyclohexyl]iminomethyl]-5-methylphenol (PubChem CID 159587394) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-[[2-[(2-hydroxy-4-methylphenyl)methylideneamino]cyclohexyl]iminomethyl]-5-methylphenol.
| Compound Name | 2-[[2-[(2-hydroxy-4-methylphenyl)methylideneamino]cyclohexyl]iminomethyl]-5-methylphenol |
|---|---|
| PubChem CID | 159587394 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-[[2-[(2-hydroxy-4-methylphenyl)methylideneamino]cyclohexyl]iminomethyl]-5-methylphenol |
| SMILES | Cc1ccc(/C=N/C2CCCCC2/N=C/c2ccc(C)cc2O)c(O)c1 |
| InChI | InChI=1S/C22H26N2O2/c1-15-7-9-17(21(25)11-15)13-23-19-5-3-4-6-20(19)24-14-18-10-8-16(2)12-22(18)26/h7-14,19-20,25-26H,3-6H2,1-2H3/b23-13+,24-14+ |
| InChIKey | NYXNBLWQTLWVJN-RNIAWFEPSA-N |
| XLogP | 4.56 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|