C8H9NO3 — CID 137269363
4-[(E)-hydroxyiminomethyl]-3-methylbenzene-1,2-diol (PubChem CID 137269363) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 4-[(E)-hydroxyiminomethyl]-3-methylbenzene-1,2-diol.
| Compound Name | 4-[(E)-hydroxyiminomethyl]-3-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 137269363 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 4-[(E)-hydroxyiminomethyl]-3-methylbenzene-1,2-diol |
| SMILES | Cc1c(/C=N/O)ccc(O)c1O |
| InChI | InChI=1S/C8H9NO3/c1-5-6(4-9-12)2-3-7(10)8(5)11/h2-4,10-12H,1H3/b9-4+ |
| InChIKey | WPEIAHIIFRWXQW-RUDMXATFSA-N |
| XLogP | 1.21 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|