C8H9NO4 — CID 137257561
2-[(E)-hydroxyiminomethyl]-4-methylbenzene-1,3,5-triol (PubChem CID 137257561) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 2-[(E)-hydroxyiminomethyl]-4-methylbenzene-1,3,5-triol.
| Compound Name | 2-[(E)-hydroxyiminomethyl]-4-methylbenzene-1,3,5-triol |
|---|---|
| PubChem CID | 137257561 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 2-[(E)-hydroxyiminomethyl]-4-methylbenzene-1,3,5-triol |
| SMILES | Cc1c(O)cc(O)c(/C=N/O)c1O |
| InChI | InChI=1S/C8H9NO4/c1-4-6(10)2-7(11)5(3-9-13)8(4)12/h2-3,10-13H,1H3/b9-3+ |
| InChIKey | WTNWLYLIJNZOOE-YCRREMRBSA-N |
| XLogP | 0.92 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|