C8H8N2O4 — CID 135436317
5-[(Z)-hydroxyiminomethyl]-3-[(E)-hydroxyiminomethyl]benzene-1,2-diol (PubChem CID 135436317) has the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. Its IUPAC name is 5-[(Z)-hydroxyiminomethyl]-3-[(E)-hydroxyiminomethyl]benzene-1,2-diol.
| Compound Name | 5-[(Z)-hydroxyiminomethyl]-3-[(E)-hydroxyiminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135436317 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 5-[(Z)-hydroxyiminomethyl]-3-[(E)-hydroxyiminomethyl]benzene-1,2-diol |
| SMILES | O/N=C\c1cc(O)c(O)c(/C=N/O)c1 |
| InChI | InChI=1S/C8H8N2O4/c11-7-2-5(3-9-13)1-6(4-10-14)8(7)12/h1-4,11-14H/b9-3-,10-4+ |
| InChIKey | RVXQVCZJDDAKEE-INWPEIIHSA-N |
| XLogP | 0.71 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|