C14H20N2O3 — CID 137225203
2,4-bis(propyliminomethyl)benzene-1,3,5-triol (PubChem CID 137225203) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2,4-bis(propyliminomethyl)benzene-1,3,5-triol.
| Compound Name | 2,4-bis(propyliminomethyl)benzene-1,3,5-triol |
|---|---|
| PubChem CID | 137225203 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2,4-bis(propyliminomethyl)benzene-1,3,5-triol |
| SMILES | CCC/N=C/c1c(O)cc(O)c(/C=N/CCC)c1O |
| InChI | InChI=1S/C14H20N2O3/c1-3-5-15-8-10-12(17)7-13(18)11(14(10)19)9-16-6-4-2/h7-9,17-19H,3-6H2,1-2H3/b15-8+,16-9+ |
| InChIKey | POTMNJGLWRHTLD-BVXMOGEKSA-N |
| XLogP | 2.46 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|