C10H15N — CID 142957690
1-(4-methylcyclopenta-1,3-dien-1-yl)-N-propylmethanimine (PubChem CID 142957690) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 1-(4-methylcyclopenta-1,3-dien-1-yl)-N-propylmethanimine.
| Compound Name | 1-(4-methylcyclopenta-1,3-dien-1-yl)-N-propylmethanimine |
|---|---|
| PubChem CID | 142957690 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1-(4-methylcyclopenta-1,3-dien-1-yl)-N-propylmethanimine |
| SMILES | CCC/N=C/C1=CC=C(C)C1 |
| InChI | InChI=1S/C10H15N/c1-3-6-11-8-10-5-4-9(2)7-10/h4-5,8H,3,6-7H2,1-2H3/b11-8+ |
| InChIKey | YUWLZJIFCMRGKJ-DHZHZOJOSA-N |
| XLogP | 2.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|