C7H11N3O2 — CID 156709953
4-hydroxy-5-(propyliminomethyl)-1,3-dihydroimidazol-2-one (PubChem CID 156709953) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-hydroxy-5-(propyliminomethyl)-1,3-dihydroimidazol-2-one.
| Compound Name | 4-hydroxy-5-(propyliminomethyl)-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 156709953 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-hydroxy-5-(propyliminomethyl)-1,3-dihydroimidazol-2-one |
| SMILES | CCC/N=C/c1[nH]c(=O)[nH]c1O |
| InChI | InChI=1S/C7H11N3O2/c1-2-3-8-4-5-6(11)10-7(12)9-5/h4,11H,2-3H2,1H3,(H2,9,10,12)/b8-4+ |
| InChIKey | RYUPAMIOXDYEIQ-XBXARRHUSA-N |
| XLogP | 0.24 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|