C12H16N4O4 — CID 2172238
6-hydroxy-5-[3-(2-oxopyrrolidin-1-yl)propyliminomethyl]-1H-pyrimidine-2,4-dione (PubChem CID 2172238) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 6-hydroxy-5-[3-(2-oxopyrrolidin-1-yl)propyliminomethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[3-(2-oxopyrrolidin-1-yl)propyliminomethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2172238 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 6-hydroxy-5-[3-(2-oxopyrrolidin-1-yl)propyliminomethyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=C1CCCN1CCC/N=C/c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H16N4O4/c17-9-3-1-5-16(9)6-2-4-13-7-8-10(18)14-12(20)15-11(8)19/h7H,1-6H2,(H3,14,15,18,19,20)/b13-7+ |
| InChIKey | RGUFSAOERUCJHX-NTUHNPAUSA-N |
| XLogP | -0.80 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|