C14H16Cl2N2O2 — CID 135595142
1-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]pyrrolidin-2-one (PubChem CID 135595142) has the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.20 g/mol. Its IUPAC name is 1-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 135595142 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCC/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C14H16Cl2N2O2/c15-11-7-10(14(20)12(16)8-11)9-17-4-2-6-18-5-1-3-13(18)19/h7-9,20H,1-6H2/b17-9+ |
| InChIKey | WDFIVVSXPIYNBA-RQZCQDPDSA-N |
| XLogP | 3.13 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|