C16H28N4O3 — CID 11723775
6-(dodecylamino)-5-nitroso-1H-pyrimidine-2,4-dione (PubChem CID 11723775) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is 6-(dodecylamino)-5-nitroso-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(dodecylamino)-5-nitroso-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11723775 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 6-(dodecylamino)-5-nitroso-1H-pyrimidine-2,4-dione |
| SMILES | CCCCCCCCCCCCNc1[nH]c(=O)[nH]c(=O)c1N=O |
| InChI | InChI=1S/C16H28N4O3/c1-2-3-4-5-6-7-8-9-10-11-12-17-14-13(20-23)15(21)19-16(22)18-14/h2-12H2,1H3,(H3,17,18,19,21,22) |
| InChIKey | GSVWUPJNSNYYPZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|