C17H31N3O2 — CID 12782102
6-(dodecylamino)-3-methyl-1H-pyrimidine-2,4-dione (PubChem CID 12782102) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is 6-(dodecylamino)-3-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(dodecylamino)-3-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 12782102 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | 6-(dodecylamino)-3-methyl-1H-pyrimidine-2,4-dione |
| SMILES | CCCCCCCCCCCCNc1cc(=O)n(C)c(=O)[nH]1 |
| InChI | InChI=1S/C17H31N3O2/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-16(21)20(2)17(22)19-15/h14,18H,3-13H2,1-2H3,(H,19,22) |
| InChIKey | BTYAJMXPCPUKDP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|